C23H32N4O5 — CID 27968344
ethyl 4-[[2-[(E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]oxyacetyl]amino]piperidine-1-carboxylate (PubChem CID 27968344) has the molecular formula C23H32N4O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is ethyl 4-[[2-[(E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]oxyacetyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-[(E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]oxyacetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 27968344 |
| Molecular Formula | C23H32N4O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | ethyl 4-[[2-[(E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]oxyacetyl]amino]piperidine-1-carboxylate |
| SMILES | CCCn1c(C)cc(/C=C(\C#N)C(=O)OCC(=O)NC2CCN(C(=O)OCC)CC2)c1C |
| InChI | InChI=1S/C23H32N4O5/c1-5-9-27-16(3)12-18(17(27)4)13-19(14-24)22(29)32-15-21(28)25-20-7-10-26(11-8-20)23(30)31-6-2/h12-13,20H,5-11,15H2,1-4H3,(H,25,28)/b19-13+ |
| InChIKey | MUCJWPHSQGDUOE-CPNJWEJPSA-N |
| XLogP | 2.70 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|