C23H27ClN4O3S — CID 78769069
(Z)-N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enamide (PubChem CID 78769069) has the molecular formula C23H27ClN4O3S and a molecular weight of 475.01 g/mol. Its IUPAC name is (Z)-N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enamide.
| Compound Name | (Z)-N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 78769069 |
| Molecular Formula | C23H27ClN4O3S |
| Molecular Weight | 475.01 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | (Z)-N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enamide |
| SMILES | CCCn1c(C)cc(/C=C(/C#N)C(=O)Nc2ccc(Cl)c(S(=O)(=O)N3CCCC3)c2)c1C |
| InChI | InChI=1S/C23H27ClN4O3S/c1-4-9-28-16(2)12-18(17(28)3)13-19(15-25)23(29)26-20-7-8-21(24)22(14-20)32(30,31)27-10-5-6-11-27/h7-8,12-14H,4-6,9-11H2,1-3H3,(H,26,29)/b19-13- |
| InChIKey | AIFAIYAYAGTNLD-UYRXBGFRSA-N |
| XLogP | 4.50 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.01 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|