C28H27N5O3 — CID 55750760
(Z)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)phenyl]prop-2-enamide (PubChem CID 55750760) has the molecular formula C28H27N5O3 and a molecular weight of 481.56 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55750760 |
| Molecular Formula | C28H27N5O3 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | (Z)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)phenyl]prop-2-enamide |
| SMILES | CCCn1c(C)cc(/C=C(/C#N)C(=O)Nc2ccc(C(=O)N3CC(=O)Nc4ccccc43)cc2)c1C |
| InChI | InChI=1S/C28H27N5O3/c1-4-13-32-18(2)14-21(19(32)3)15-22(16-29)27(35)30-23-11-9-20(10-12-23)28(36)33-17-26(34)31-24-7-5-6-8-25(24)33/h5-12,14-15H,4,13,17H2,1-3H3,(H,30,35)(H,31,34)/b22-15- |
| InChIKey | DPDMUPDCFOSNQH-JCMHNJIXSA-N |
| XLogP | 4.66 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|