C19H18F3N3O — CID 46797535
(E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-(2,3,4-trifluorophenyl)prop-2-enamide (PubChem CID 46797535) has the molecular formula C19H18F3N3O and a molecular weight of 361.37 g/mol. Its IUPAC name is (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-(2,3,4-trifluorophenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-(2,3,4-trifluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 46797535 |
| Molecular Formula | C19H18F3N3O |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-(2,3,4-trifluorophenyl)prop-2-enamide |
| SMILES | CCCn1c(C)cc(/C=C(\C#N)C(=O)Nc2ccc(F)c(F)c2F)c1C |
| InChI | InChI=1S/C19H18F3N3O/c1-4-7-25-11(2)8-13(12(25)3)9-14(10-23)19(26)24-16-6-5-15(20)17(21)18(16)22/h5-6,8-9H,4,7H2,1-3H3,(H,24,26)/b14-9+ |
| InChIKey | TWWMREIHDRCBDC-NTEUORMPSA-N |
| XLogP | 4.48 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|