C21H24FN3O — CID 33195892
(E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-[2-(2-fluorophenyl)ethyl]prop-2-enamide (PubChem CID 33195892) has the molecular formula C21H24FN3O and a molecular weight of 353.44 g/mol. Its IUPAC name is (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-[2-(2-fluorophenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-[2-(2-fluorophenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 33195892 |
| Molecular Formula | C21H24FN3O |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-[2-(2-fluorophenyl)ethyl]prop-2-enamide |
| SMILES | CCCn1c(C)cc(/C=C(\C#N)C(=O)NCCc2ccccc2F)c1C |
| InChI | InChI=1S/C21H24FN3O/c1-4-11-25-15(2)12-18(16(25)3)13-19(14-23)21(26)24-10-9-17-7-5-6-8-20(17)22/h5-8,12-13H,4,9-11H2,1-3H3,(H,24,26)/b19-13+ |
| InChIKey | BCBUSCROWMKDJJ-CPNJWEJPSA-N |
| XLogP | 3.92 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|