C26H23FN4O — CID 1276415
(E)-2-cyano-3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide (PubChem CID 1276415) has the molecular formula C26H23FN4O and a molecular weight of 426.50 g/mol. Its IUPAC name is (E)-2-cyano-3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 1276415 |
| Molecular Formula | C26H23FN4O |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | (E)-2-cyano-3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)NCCc2c[nH]c3ccccc23)c(C)n1-c1ccccc1F |
| InChI | InChI=1S/C26H23FN4O/c1-17-13-20(18(2)31(17)25-10-6-4-8-23(25)27)14-21(15-28)26(32)29-12-11-19-16-30-24-9-5-3-7-22(19)24/h3-10,13-14,16,30H,11-12H2,1-2H3,(H,29,32)/b21-14+ |
| InChIKey | HSKTZIBHECMAED-KGENOOAVSA-N |
| XLogP | 4.98 |
| TPSA | 73.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|