C19H17N3OS — CID 5226150
2-cyano-N-[2-(1H-indol-3-yl)ethyl]-3-(3-methylthiophen-2-yl)prop-2-enamide (PubChem CID 5226150) has the molecular formula C19H17N3OS and a molecular weight of 335.43 g/mol. Its IUPAC name is 2-cyano-N-[2-(1H-indol-3-yl)ethyl]-3-(3-methylthiophen-2-yl)prop-2-enamide.
| Compound Name | 2-cyano-N-[2-(1H-indol-3-yl)ethyl]-3-(3-methylthiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 5226150 |
| Molecular Formula | C19H17N3OS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 2-cyano-N-[2-(1H-indol-3-yl)ethyl]-3-(3-methylthiophen-2-yl)prop-2-enamide |
| SMILES | Cc1ccsc1C=C(C#N)C(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H17N3OS/c1-13-7-9-24-18(13)10-15(11-20)19(23)21-8-6-14-12-22-17-5-3-2-4-16(14)17/h2-5,7,9-10,12,22H,6,8H2,1H3,(H,21,23) |
| InChIKey | WFRCZOIYFKOEBI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|