C26H21N3O4 — CID 6106209
methyl 2-[5-[(E)-2-cyano-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]furan-2-yl]benzoate (PubChem CID 6106209) has the molecular formula C26H21N3O4 and a molecular weight of 439.47 g/mol. Its IUPAC name is methyl 2-[5-[(E)-2-cyano-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]furan-2-yl]benzoate.
| Compound Name | methyl 2-[5-[(E)-2-cyano-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 6106209 |
| Molecular Formula | C26H21N3O4 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | methyl 2-[5-[(E)-2-cyano-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccccc1-c1ccc(/C=C(\C#N)C(=O)NCCc2c[nH]c3ccccc23)o1 |
| InChI | InChI=1S/C26H21N3O4/c1-32-26(31)22-8-3-2-7-21(22)24-11-10-19(33-24)14-18(15-27)25(30)28-13-12-17-16-29-23-9-5-4-6-20(17)23/h2-11,14,16,29H,12-13H2,1H3,(H,28,30)/b18-14+ |
| InChIKey | UALVIHHQWUWMMV-NBVRZTHBSA-N |
| XLogP | 4.48 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|