C22H24N4O4 — CID 122547462
(E)-2-cyano-3-[5-[2-(2-hydroxyethoxy)ethylamino]furan-2-yl]-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide (PubChem CID 122547462) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[2-(2-hydroxyethoxy)ethylamino]furan-2-yl]-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[5-[2-(2-hydroxyethoxy)ethylamino]furan-2-yl]-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 122547462 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | (E)-2-cyano-3-[5-[2-(2-hydroxyethoxy)ethylamino]furan-2-yl]-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(NCCOCCO)o1)C(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H24N4O4/c23-14-17(13-18-5-6-21(30-18)24-9-11-29-12-10-27)22(28)25-8-7-16-15-26-20-4-2-1-3-19(16)20/h1-6,13,15,24,26-27H,7-12H2,(H,25,28)/b17-13+ |
| InChIKey | MHBHYZDTNJMDMY-GHRIWEEISA-N |
| XLogP | 2.45 |
| TPSA | 123.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|