C27H22N4O4 — CID 5035575
2-cyano-N-[2-(1H-indol-3-yl)ethyl]-3-[2-[(4-nitrophenyl)methoxy]phenyl]prop-2-enamide (PubChem CID 5035575) has the molecular formula C27H22N4O4 and a molecular weight of 466.50 g/mol. Its IUPAC name is 2-cyano-N-[2-(1H-indol-3-yl)ethyl]-3-[2-[(4-nitrophenyl)methoxy]phenyl]prop-2-enamide.
| Compound Name | 2-cyano-N-[2-(1H-indol-3-yl)ethyl]-3-[2-[(4-nitrophenyl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 5035575 |
| Molecular Formula | C27H22N4O4 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 2-cyano-N-[2-(1H-indol-3-yl)ethyl]-3-[2-[(4-nitrophenyl)methoxy]phenyl]prop-2-enamide |
| SMILES | N#CC(=Cc1ccccc1OCc1ccc([N+](=O)[O-])cc1)C(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C27H22N4O4/c28-16-22(27(32)29-14-13-21-17-30-25-7-3-2-6-24(21)25)15-20-5-1-4-8-26(20)35-18-19-9-11-23(12-10-19)31(33)34/h1-12,15,17,30H,13-14,18H2,(H,29,32) |
| InChIKey | VNSLKTYSOVXYNM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 121.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|