C28H23ClN4O5 — CID 25251031
(Z)-3-[3-chloro-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]-2-cyano-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide (PubChem CID 25251031) has the molecular formula C28H23ClN4O5 and a molecular weight of 530.97 g/mol. Its IUPAC name is (Z)-3-[3-chloro-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]-2-cyano-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide.
| Compound Name | (Z)-3-[3-chloro-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]-2-cyano-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 25251031 |
| Molecular Formula | C28H23ClN4O5 |
| Molecular Weight | 530.97 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | (Z)-3-[3-chloro-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]-2-cyano-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)NCCc2c[nH]c3ccccc23)cc(Cl)c1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H23ClN4O5/c1-37-26-14-19(13-24(29)27(26)38-17-18-5-4-6-22(12-18)33(35)36)11-21(15-30)28(34)31-10-9-20-16-32-25-8-3-2-7-23(20)25/h2-8,11-14,16,32H,9-10,17H2,1H3,(H,31,34)/b21-11- |
| InChIKey | HXFPJQYFJOSVTD-NHDPSOOVSA-N |
| XLogP | 5.58 |
| TPSA | 130.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.97 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|