C28H23I2N3O2 — CID 124601089
(Z)-2-cyano-3-[3,5-diiodo-4-[(3-methylphenyl)methoxy]phenyl]-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide (PubChem CID 124601089) has the molecular formula C28H23I2N3O2 and a molecular weight of 687.32 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3,5-diiodo-4-[(3-methylphenyl)methoxy]phenyl]-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3,5-diiodo-4-[(3-methylphenyl)methoxy]phenyl]-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 124601089 |
| Molecular Formula | C28H23I2N3O2 |
| Molecular Weight | 687.32 g/mol |
| Exact Mass | 686.99 |
| IUPAC Name | (Z)-2-cyano-3-[3,5-diiodo-4-[(3-methylphenyl)methoxy]phenyl]-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide |
| SMILES | Cc1cccc(COc2c(I)cc(/C=C(/C#N)C(=O)NCCc3c[nH]c4ccccc34)cc2I)c1 |
| InChI | InChI=1S/C28H23I2N3O2/c1-18-5-4-6-19(11-18)17-35-27-24(29)13-20(14-25(27)30)12-22(15-31)28(34)32-10-9-21-16-33-26-8-3-2-7-23(21)26/h2-8,11-14,16,33H,9-10,17H2,1H3,(H,32,34)/b22-12- |
| InChIKey | JUNAEIQHIKVQKW-UUYOSTAYSA-N |
| XLogP | 6.53 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.32 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|