C20H16IN3O — CID 4259459
2-cyano-N-[2-(1H-indol-3-yl)ethyl]-3-(3-iodophenyl)prop-2-enamide (PubChem CID 4259459) has the molecular formula C20H16IN3O and a molecular weight of 441.27 g/mol. Its IUPAC name is 2-cyano-N-[2-(1H-indol-3-yl)ethyl]-3-(3-iodophenyl)prop-2-enamide.
| Compound Name | 2-cyano-N-[2-(1H-indol-3-yl)ethyl]-3-(3-iodophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4259459 |
| Molecular Formula | C20H16IN3O |
| Molecular Weight | 441.27 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | 2-cyano-N-[2-(1H-indol-3-yl)ethyl]-3-(3-iodophenyl)prop-2-enamide |
| SMILES | N#CC(=Cc1cccc(I)c1)C(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H16IN3O/c21-17-5-3-4-14(11-17)10-16(12-22)20(25)23-9-8-15-13-24-19-7-2-1-6-18(15)19/h1-7,10-11,13,24H,8-9H2,(H,23,25) |
| InChIKey | JJCSCCSLYXYUER-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.27 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|