C29H23FN4O — CID 3991507
2-cyano-3-[1-[(3-fluorophenyl)methyl]indol-5-yl]-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide (PubChem CID 3991507) has the molecular formula C29H23FN4O and a molecular weight of 462.53 g/mol. Its IUPAC name is 2-cyano-3-[1-[(3-fluorophenyl)methyl]indol-5-yl]-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide.
| Compound Name | 2-cyano-3-[1-[(3-fluorophenyl)methyl]indol-5-yl]-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 3991507 |
| Molecular Formula | C29H23FN4O |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 2-cyano-3-[1-[(3-fluorophenyl)methyl]indol-5-yl]-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide |
| SMILES | N#CC(=Cc1ccc2c(ccn2Cc2cccc(F)c2)c1)C(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C29H23FN4O/c30-25-5-3-4-21(16-25)19-34-13-11-22-14-20(8-9-28(22)34)15-24(17-31)29(35)32-12-10-23-18-33-27-7-2-1-6-26(23)27/h1-9,11,13-16,18,33H,10,12,19H2,(H,32,35) |
| InChIKey | UYFYEEVZXYFSGI-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 73.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|