C25H25N3O5 — CID 3144057
methyl 2-[4-[2-cyano-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]-2-ethoxyphenoxy]acetate (PubChem CID 3144057) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is methyl 2-[4-[2-cyano-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]-2-ethoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[2-cyano-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]-2-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 3144057 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | methyl 2-[4-[2-cyano-3-[2-(1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]-2-ethoxyphenoxy]acetate |
| SMILES | CCOc1cc(C=C(C#N)C(=O)NCCc2c[nH]c3ccccc23)ccc1OCC(=O)OC |
| InChI | InChI=1S/C25H25N3O5/c1-3-32-23-13-17(8-9-22(23)33-16-24(29)31-2)12-19(14-26)25(30)27-11-10-18-15-28-21-7-5-4-6-20(18)21/h4-9,12-13,15,28H,3,10-11,16H2,1-2H3,(H,27,30) |
| InChIKey | MUGPBGIWAIUWSH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|