C21H24N2O3 — CID 27645310
3,4-diethoxy-N-[2-(1H-indol-3-yl)ethyl]benzamide (PubChem CID 27645310) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 3,4-diethoxy-N-[2-(1H-indol-3-yl)ethyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[2-(1H-indol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 27645310 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 3,4-diethoxy-N-[2-(1H-indol-3-yl)ethyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCCc2c[nH]c3ccccc23)cc1OCC |
| InChI | InChI=1S/C21H24N2O3/c1-3-25-19-10-9-15(13-20(19)26-4-2)21(24)22-12-11-16-14-23-18-8-6-5-7-17(16)18/h5-10,13-14,23H,3-4,11-12H2,1-2H3,(H,22,24) |
| InChIKey | NFJCIJKUNGWNDX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |