C28H24ClN3O3 — CID 3804520
3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-2-cyano-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide (PubChem CID 3804520) has the molecular formula C28H24ClN3O3 and a molecular weight of 485.97 g/mol. Its IUPAC name is 3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-2-cyano-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide.
| Compound Name | 3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-2-cyano-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 3804520 |
| Molecular Formula | C28H24ClN3O3 |
| Molecular Weight | 485.97 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-2-cyano-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide |
| SMILES | COc1cc(C=C(C#N)C(=O)NCCc2c[nH]c3ccccc23)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H24ClN3O3/c1-34-27-15-20(8-11-26(27)35-18-19-6-9-23(29)10-7-19)14-22(16-30)28(33)31-13-12-21-17-32-25-5-3-2-4-24(21)25/h2-11,14-15,17,32H,12-13,18H2,1H3,(H,31,33) |
| InChIKey | JQDPGWLBLSPZOW-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.97 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|