C27H21ClN2O3 — CID 3279362
3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-2-(2-methyl-1H-indole-3-carbonyl)prop-2-enenitrile (PubChem CID 3279362) has the molecular formula C27H21ClN2O3 and a molecular weight of 456.93 g/mol. Its IUPAC name is 3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-2-(2-methyl-1H-indole-3-carbonyl)prop-2-enenitrile.
| Compound Name | 3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-2-(2-methyl-1H-indole-3-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3279362 |
| Molecular Formula | C27H21ClN2O3 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-2-(2-methyl-1H-indole-3-carbonyl)prop-2-enenitrile |
| SMILES | COc1cc(C=C(C#N)C(=O)c2c(C)[nH]c3ccccc23)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H21ClN2O3/c1-17-26(22-5-3-4-6-23(22)30-17)27(31)20(15-29)13-19-9-12-24(25(14-19)32-2)33-16-18-7-10-21(28)11-8-18/h3-14,30H,16H2,1-2H3 |
| InChIKey | WAXYAPKOHXMBSL-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|