C25H20ClNO3 — CID 21381865
(E)-2-benzoyl-3-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]prop-2-enenitrile (PubChem CID 21381865) has the molecular formula C25H20ClNO3 and a molecular weight of 417.89 g/mol. Its IUPAC name is (E)-2-benzoyl-3-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]prop-2-enenitrile.
| Compound Name | (E)-2-benzoyl-3-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 21381865 |
| Molecular Formula | C25H20ClNO3 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | (E)-2-benzoyl-3-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)c2ccccc2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H20ClNO3/c1-2-29-24-15-19(14-21(16-27)25(28)20-6-4-3-5-7-20)10-13-23(24)30-17-18-8-11-22(26)12-9-18/h3-15H,2,17H2,1H3/b21-14+ |
| InChIKey | ZFWXPFJZTVVUHS-KGENOOAVSA-N |
| XLogP | 6.11 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|