C25H21NO4 — CID 126074145
4-[[4-[(Z)-2-cyano-2-phenylethenyl]-2-ethoxyphenoxy]methyl]benzoic acid (PubChem CID 126074145) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 4-[[4-[(Z)-2-cyano-2-phenylethenyl]-2-ethoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(Z)-2-cyano-2-phenylethenyl]-2-ethoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126074145 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 4-[[4-[(Z)-2-cyano-2-phenylethenyl]-2-ethoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=C(\C#N)c2ccccc2)ccc1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H21NO4/c1-2-29-24-15-19(14-22(16-26)20-6-4-3-5-7-20)10-13-23(24)30-17-18-8-11-21(12-9-18)25(27)28/h3-15H,2,17H2,1H3,(H,27,28)/b22-14+ |
| InChIKey | RDSVBKAQIFXINP-HYARGMPZSA-N |
| XLogP | 5.43 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|