C29H25NO2 — CID 21375094
(E)-3-[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]-2-(4-methylphenyl)prop-2-enenitrile (PubChem CID 21375094) has the molecular formula C29H25NO2 and a molecular weight of 419.52 g/mol. Its IUPAC name is (E)-3-[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]-2-(4-methylphenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]-2-(4-methylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 21375094 |
| Molecular Formula | C29H25NO2 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | (E)-3-[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]-2-(4-methylphenyl)prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(/C#N)c2ccc(C)cc2)ccc1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C29H25NO2/c1-3-31-29-18-22(16-27(19-30)25-12-8-21(2)9-13-25)11-15-28(29)32-20-23-10-14-24-6-4-5-7-26(24)17-23/h4-18H,3,20H2,1-2H3/b27-16- |
| InChIKey | IWMRIWOBDIBDBB-YUMHPJSZSA-N |
| XLogP | 7.19 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|