C24H20FNO2 — CID 124548617
(E)-3-(3-ethoxy-4-phenylmethoxyphenyl)-2-(2-fluorophenyl)prop-2-enenitrile (PubChem CID 124548617) has the molecular formula C24H20FNO2 and a molecular weight of 373.43 g/mol. Its IUPAC name is (E)-3-(3-ethoxy-4-phenylmethoxyphenyl)-2-(2-fluorophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-(3-ethoxy-4-phenylmethoxyphenyl)-2-(2-fluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 124548617 |
| Molecular Formula | C24H20FNO2 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | (E)-3-(3-ethoxy-4-phenylmethoxyphenyl)-2-(2-fluorophenyl)prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(/C#N)c2ccccc2F)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H20FNO2/c1-2-27-24-15-19(14-20(16-26)21-10-6-7-11-22(21)25)12-13-23(24)28-17-18-8-4-3-5-9-18/h3-15H,2,17H2,1H3/b20-14- |
| InChIKey | FGKGTDYUPQDHLM-ZHZULCJRSA-N |
| XLogP | 5.87 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|