C24H18BrFINO2 — CID 126375792
(E)-3-[3-bromo-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]-2-(2-fluorophenyl)prop-2-enenitrile (PubChem CID 126375792) has the molecular formula C24H18BrFINO2 and a molecular weight of 578.22 g/mol. Its IUPAC name is (E)-3-[3-bromo-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]-2-(2-fluorophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[3-bromo-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]-2-(2-fluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126375792 |
| Molecular Formula | C24H18BrFINO2 |
| Molecular Weight | 578.22 g/mol |
| Exact Mass | 576.95 |
| IUPAC Name | (E)-3-[3-bromo-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]-2-(2-fluorophenyl)prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(/C#N)c2ccccc2F)cc(Br)c1OCc1ccc(I)cc1 |
| InChI | InChI=1S/C24H18BrFINO2/c1-2-29-23-13-17(11-18(14-28)20-5-3-4-6-22(20)26)12-21(25)24(23)30-15-16-7-9-19(27)10-8-16/h3-13H,2,15H2,1H3/b18-11- |
| InChIKey | BVSJFQAAAWTMOX-WQRHYEAKSA-N |
| XLogP | 7.23 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.22 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|