C23H15BrCl2FNO2 — CID 126376917
(E)-3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-(2-fluorophenyl)prop-2-enenitrile (PubChem CID 126376917) has the molecular formula C23H15BrCl2FNO2 and a molecular weight of 507.19 g/mol. Its IUPAC name is (E)-3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-(2-fluorophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-(2-fluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126376917 |
| Molecular Formula | C23H15BrCl2FNO2 |
| Molecular Weight | 507.19 g/mol |
| Exact Mass | 504.96 |
| IUPAC Name | (E)-3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-(2-fluorophenyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(/C#N)c2ccccc2F)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H15BrCl2FNO2/c1-29-22-10-14(8-16(12-28)18-4-2-3-5-21(18)27)9-19(24)23(22)30-13-15-6-7-17(25)11-20(15)26/h2-11H,13H2,1H3/b16-8- |
| InChIKey | VDCIAAQGZPDCPH-PXNMLYILSA-N |
| XLogP | 7.55 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.19 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|