C27H22Cl2FNO2 — CID 124551685
(E)-3-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-2-(2-fluorophenyl)prop-2-enenitrile (PubChem CID 124551685) has the molecular formula C27H22Cl2FNO2 and a molecular weight of 482.38 g/mol. Its IUPAC name is (E)-3-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-2-(2-fluorophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-2-(2-fluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 124551685 |
| Molecular Formula | C27H22Cl2FNO2 |
| Molecular Weight | 482.38 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | (E)-3-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-2-(2-fluorophenyl)prop-2-enenitrile |
| SMILES | C=CCc1cc(/C=C(/C#N)c2ccccc2F)cc(OCC)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H22Cl2FNO2/c1-3-7-19-12-18(13-21(16-31)23-8-5-6-9-25(23)30)14-26(32-4-2)27(19)33-17-20-10-11-22(28)15-24(20)29/h3,5-6,8-15H,1,4,7,17H2,2H3/b21-13- |
| InChIKey | DLVMVMIDPPRJMV-BKUYFWCQSA-N |
| XLogP | 7.90 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.38 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|