C24H19FINO2 — CID 3410954
3-(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)-2-(2-fluorophenyl)prop-2-enenitrile (PubChem CID 3410954) has the molecular formula C24H19FINO2 and a molecular weight of 499.32 g/mol. Its IUPAC name is 3-(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)-2-(2-fluorophenyl)prop-2-enenitrile.
| Compound Name | 3-(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)-2-(2-fluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3410954 |
| Molecular Formula | C24H19FINO2 |
| Molecular Weight | 499.32 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | 3-(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)-2-(2-fluorophenyl)prop-2-enenitrile |
| SMILES | CCOc1cc(C=C(C#N)c2ccccc2F)cc(I)c1OCc1ccccc1 |
| InChI | InChI=1S/C24H19FINO2/c1-2-28-23-14-18(12-19(15-27)20-10-6-7-11-21(20)25)13-22(26)24(23)29-16-17-8-4-3-5-9-17/h3-14H,2,16H2,1H3 |
| InChIKey | UQVHKOPYZAZBLG-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.32 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|