C22H14ClI2NO — CID 5234257
2-(2-chlorophenyl)-3-(3,5-diiodo-4-phenylmethoxyphenyl)prop-2-enenitrile (PubChem CID 5234257) has the molecular formula C22H14ClI2NO and a molecular weight of 597.62 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-3-(3,5-diiodo-4-phenylmethoxyphenyl)prop-2-enenitrile.
| Compound Name | 2-(2-chlorophenyl)-3-(3,5-diiodo-4-phenylmethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 5234257 |
| Molecular Formula | C22H14ClI2NO |
| Molecular Weight | 597.62 g/mol |
| Exact Mass | 596.89 |
| IUPAC Name | 2-(2-chlorophenyl)-3-(3,5-diiodo-4-phenylmethoxyphenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1cc(I)c(OCc2ccccc2)c(I)c1)c1ccccc1Cl |
| InChI | InChI=1S/C22H14ClI2NO/c23-19-9-5-4-8-18(19)17(13-26)10-16-11-20(24)22(21(25)12-16)27-14-15-6-2-1-3-7-15/h1-12H,14H2 |
| InChIKey | BOACRDSMTIMHBZ-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.62 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|