C26H16Br2ClNO — CID 4261726
2-(2-chlorophenyl)-3-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enenitrile (PubChem CID 4261726) has the molecular formula C26H16Br2ClNO and a molecular weight of 553.68 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-3-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enenitrile.
| Compound Name | 2-(2-chlorophenyl)-3-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4261726 |
| Molecular Formula | C26H16Br2ClNO |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 550.93 |
| IUPAC Name | 2-(2-chlorophenyl)-3-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1cc(Br)c(OCc2cccc3ccccc23)c(Br)c1)c1ccccc1Cl |
| InChI | InChI=1S/C26H16Br2ClNO/c27-23-13-17(12-20(15-30)22-10-3-4-11-25(22)29)14-24(28)26(23)31-16-19-8-5-7-18-6-1-2-9-21(18)19/h1-14H,16H2 |
| InChIKey | BUEPWKCHORCKGE-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|