C27H19BrClNO2 — CID 4588218
3-[3-bromo-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]-2-(2-chlorophenyl)prop-2-enenitrile (PubChem CID 4588218) has the molecular formula C27H19BrClNO2 and a molecular weight of 504.81 g/mol. Its IUPAC name is 3-[3-bromo-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]-2-(2-chlorophenyl)prop-2-enenitrile.
| Compound Name | 3-[3-bromo-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]-2-(2-chlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4588218 |
| Molecular Formula | C27H19BrClNO2 |
| Molecular Weight | 504.81 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | 3-[3-bromo-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]-2-(2-chlorophenyl)prop-2-enenitrile |
| SMILES | COc1cc(C=C(C#N)c2ccccc2Cl)cc(Br)c1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H19BrClNO2/c1-31-26-15-19(13-22(16-30)23-8-4-5-9-25(23)29)14-24(28)27(26)32-17-18-10-11-20-6-2-3-7-21(20)12-18/h2-15H,17H2,1H3 |
| InChIKey | GSMXBKKUGBAEEC-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.81 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|