C20H19BrClNO2 — CID 4276281
3-(3-bromo-4-butan-2-yloxy-5-methoxyphenyl)-2-(2-chlorophenyl)prop-2-enenitrile (PubChem CID 4276281) has the molecular formula C20H19BrClNO2 and a molecular weight of 420.73 g/mol. Its IUPAC name is 3-(3-bromo-4-butan-2-yloxy-5-methoxyphenyl)-2-(2-chlorophenyl)prop-2-enenitrile.
| Compound Name | 3-(3-bromo-4-butan-2-yloxy-5-methoxyphenyl)-2-(2-chlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4276281 |
| Molecular Formula | C20H19BrClNO2 |
| Molecular Weight | 420.73 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | 3-(3-bromo-4-butan-2-yloxy-5-methoxyphenyl)-2-(2-chlorophenyl)prop-2-enenitrile |
| SMILES | CCC(C)Oc1c(Br)cc(C=C(C#N)c2ccccc2Cl)cc1OC |
| InChI | InChI=1S/C20H19BrClNO2/c1-4-13(2)25-20-17(21)10-14(11-19(20)24-3)9-15(12-23)16-7-5-6-8-18(16)22/h5-11,13H,4H2,1-3H3 |
| InChIKey | INZITZAAMLWRSN-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.73 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|