C20H21BrN2O4 — CID 40989931
(E)-3-[3-bromo-4-[(2R)-butan-2-yl]oxy-5-methoxyphenyl]-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide (PubChem CID 40989931) has the molecular formula C20H21BrN2O4 and a molecular weight of 433.30 g/mol. Its IUPAC name is (E)-3-[3-bromo-4-[(2R)-butan-2-yl]oxy-5-methoxyphenyl]-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[3-bromo-4-[(2R)-butan-2-yl]oxy-5-methoxyphenyl]-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 40989931 |
| Molecular Formula | C20H21BrN2O4 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | (E)-3-[3-bromo-4-[(2R)-butan-2-yl]oxy-5-methoxyphenyl]-2-cyano-N-(furan-2-ylmethyl)prop-2-enamide |
| SMILES | CC[C@@H](C)Oc1c(Br)cc(/C=C(\C#N)C(=O)NCc2ccco2)cc1OC |
| InChI | InChI=1S/C20H21BrN2O4/c1-4-13(2)27-19-17(21)9-14(10-18(19)25-3)8-15(11-22)20(24)23-12-16-6-5-7-26-16/h5-10,13H,4,12H2,1-3H3,(H,23,24)/b15-8+/t13-/m1/s1 |
| InChIKey | RZUDEVWEGFVTAM-MGMWDDNKSA-N |
| XLogP | 4.45 |
| TPSA | 84.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|