C25H19BrN2O5 — CID 19195328
[4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]phenyl] (E)-3-(3-bromo-4-methoxyphenyl)prop-2-enoate (PubChem CID 19195328) has the molecular formula C25H19BrN2O5 and a molecular weight of 507.34 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]phenyl] (E)-3-(3-bromo-4-methoxyphenyl)prop-2-enoate.
| Compound Name | [4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]phenyl] (E)-3-(3-bromo-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19195328 |
| Molecular Formula | C25H19BrN2O5 |
| Molecular Weight | 507.34 g/mol |
| Exact Mass | 506.05 |
| IUPAC Name | [4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]phenyl] (E)-3-(3-bromo-4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)Oc2ccc(/C=C(\C#N)C(=O)NCc3ccco3)cc2)cc1Br |
| InChI | InChI=1S/C25H19BrN2O5/c1-31-23-10-6-18(14-22(23)26)7-11-24(29)33-20-8-4-17(5-9-20)13-19(15-27)25(30)28-16-21-3-2-12-32-21/h2-14H,16H2,1H3,(H,28,30)/b11-7+,19-13+ |
| InChIKey | SHCCZLFGWCBNIX-MMWWNLEXSA-N |
| XLogP | 4.89 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|