C23H16Br2N2O5 — CID 19196531
[4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]phenyl] 2-(2,4-dibromophenoxy)acetate (PubChem CID 19196531) has the molecular formula C23H16Br2N2O5 and a molecular weight of 560.20 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]phenyl] 2-(2,4-dibromophenoxy)acetate.
| Compound Name | [4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]phenyl] 2-(2,4-dibromophenoxy)acetate |
|---|---|
| PubChem CID | 19196531 |
| Molecular Formula | C23H16Br2N2O5 |
| Molecular Weight | 560.20 g/mol |
| Exact Mass | 557.94 |
| IUPAC Name | [4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]phenyl] 2-(2,4-dibromophenoxy)acetate |
| SMILES | N#C/C(=C\c1ccc(OC(=O)COc2ccc(Br)cc2Br)cc1)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C23H16Br2N2O5/c24-17-5-8-21(20(25)11-17)31-14-22(28)32-18-6-3-15(4-7-18)10-16(12-26)23(29)27-13-19-2-1-9-30-19/h1-11H,13-14H2,(H,27,29)/b16-10+ |
| InChIKey | VUALIRXNZSWLCC-MHWRWJLKSA-N |
| XLogP | 5.01 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.20 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|