C26H23BrN2O5 — CID 19203339
[4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]phenyl] 2-(2-bromo-4-propylphenoxy)acetate (PubChem CID 19203339) has the molecular formula C26H23BrN2O5 and a molecular weight of 523.38 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]phenyl] 2-(2-bromo-4-propylphenoxy)acetate.
| Compound Name | [4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]phenyl] 2-(2-bromo-4-propylphenoxy)acetate |
|---|---|
| PubChem CID | 19203339 |
| Molecular Formula | C26H23BrN2O5 |
| Molecular Weight | 523.38 g/mol |
| Exact Mass | 522.08 |
| IUPAC Name | [4-[(E)-2-cyano-3-(furan-2-ylmethylamino)-3-oxoprop-1-enyl]phenyl] 2-(2-bromo-4-propylphenoxy)acetate |
| SMILES | CCCc1ccc(OCC(=O)Oc2ccc(/C=C(\C#N)C(=O)NCc3ccco3)cc2)c(Br)c1 |
| InChI | InChI=1S/C26H23BrN2O5/c1-2-4-18-8-11-24(23(27)14-18)33-17-25(30)34-21-9-6-19(7-10-21)13-20(15-28)26(31)29-16-22-5-3-12-32-22/h3,5-14H,2,4,16-17H2,1H3,(H,29,31)/b20-13+ |
| InChIKey | VMKYVPWSMQZIBE-DEDYPNTBSA-N |
| XLogP | 5.20 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|