C21H17BrN2O3 — CID 19219976
[4-(2,2-dicyanoethenyl)phenyl] 2-(2-bromo-4-propylphenoxy)acetate (PubChem CID 19219976) has the molecular formula C21H17BrN2O3 and a molecular weight of 425.28 g/mol. Its IUPAC name is [4-(2,2-dicyanoethenyl)phenyl] 2-(2-bromo-4-propylphenoxy)acetate.
| Compound Name | [4-(2,2-dicyanoethenyl)phenyl] 2-(2-bromo-4-propylphenoxy)acetate |
|---|---|
| PubChem CID | 19219976 |
| Molecular Formula | C21H17BrN2O3 |
| Molecular Weight | 425.28 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | [4-(2,2-dicyanoethenyl)phenyl] 2-(2-bromo-4-propylphenoxy)acetate |
| SMILES | CCCc1ccc(OCC(=O)Oc2ccc(C=C(C#N)C#N)cc2)c(Br)c1 |
| InChI | InChI=1S/C21H17BrN2O3/c1-2-3-15-6-9-20(19(22)11-15)26-14-21(25)27-18-7-4-16(5-8-18)10-17(12-23)13-24/h4-11H,2-3,14H2,1H3 |
| InChIKey | QNKPNGQHHOMMOB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 83.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.28 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|