C20H16N2O3 — CID 19217544
[4-(2,2-dicyanoethenyl)phenyl] 2-(3,5-dimethylphenoxy)acetate (PubChem CID 19217544) has the molecular formula C20H16N2O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is [4-(2,2-dicyanoethenyl)phenyl] 2-(3,5-dimethylphenoxy)acetate.
| Compound Name | [4-(2,2-dicyanoethenyl)phenyl] 2-(3,5-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 19217544 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | [4-(2,2-dicyanoethenyl)phenyl] 2-(3,5-dimethylphenoxy)acetate |
| SMILES | Cc1cc(C)cc(OCC(=O)Oc2ccc(C=C(C#N)C#N)cc2)c1 |
| InChI | InChI=1S/C20H16N2O3/c1-14-7-15(2)9-19(8-14)24-13-20(23)25-18-5-3-16(4-6-18)10-17(11-21)12-22/h3-10H,13H2,1-2H3 |
| InChIKey | QUMVEORHIQULLW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 83.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|