C22H20N2O3 — CID 19218965
[4-(2,2-dicyanoethenyl)phenyl] 4-(2,5-dimethylphenoxy)butanoate (PubChem CID 19218965) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is [4-(2,2-dicyanoethenyl)phenyl] 4-(2,5-dimethylphenoxy)butanoate.
| Compound Name | [4-(2,2-dicyanoethenyl)phenyl] 4-(2,5-dimethylphenoxy)butanoate |
|---|---|
| PubChem CID | 19218965 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | [4-(2,2-dicyanoethenyl)phenyl] 4-(2,5-dimethylphenoxy)butanoate |
| SMILES | Cc1ccc(C)c(OCCCC(=O)Oc2ccc(C=C(C#N)C#N)cc2)c1 |
| InChI | InChI=1S/C22H20N2O3/c1-16-5-6-17(2)21(12-16)26-11-3-4-22(25)27-20-9-7-18(8-10-20)13-19(14-23)15-24/h5-10,12-13H,3-4,11H2,1-2H3 |
| InChIKey | OVPRCNJWSOMMLF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 83.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|