C19H20O4 — CID 22684221
3-[4-[2-(2,5-dimethylphenoxy)ethoxy]phenyl]prop-2-enoic acid (PubChem CID 22684221) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-[4-[2-(2,5-dimethylphenoxy)ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[2-(2,5-dimethylphenoxy)ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22684221 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 3-[4-[2-(2,5-dimethylphenoxy)ethoxy]phenyl]prop-2-enoic acid |
| SMILES | Cc1ccc(C)c(OCCOc2ccc(C=CC(=O)O)cc2)c1 |
| InChI | InChI=1S/C19H20O4/c1-14-3-4-15(2)18(13-14)23-12-11-22-17-8-5-16(6-9-17)7-10-19(20)21/h3-10,13H,11-12H2,1-2H3,(H,20,21) |
| InChIKey | RABFDNIENNEXCE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|