C21H23ClO5 — CID 22686730
3-[3-chloro-4-[2-(2,5-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]prop-2-enoic acid (PubChem CID 22686730) has the molecular formula C21H23ClO5 and a molecular weight of 390.86 g/mol. Its IUPAC name is 3-[3-chloro-4-[2-(2,5-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[3-chloro-4-[2-(2,5-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22686730 |
| Molecular Formula | C21H23ClO5 |
| Molecular Weight | 390.86 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 3-[3-chloro-4-[2-(2,5-dimethylphenoxy)ethoxy]-5-ethoxyphenyl]prop-2-enoic acid |
| SMILES | CCOc1cc(C=CC(=O)O)cc(Cl)c1OCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C21H23ClO5/c1-4-25-19-13-16(7-8-20(23)24)12-17(22)21(19)27-10-9-26-18-11-14(2)5-6-15(18)3/h5-8,11-13H,4,9-10H2,1-3H3,(H,23,24) |
| InChIKey | CWUGMUDCWBPMMD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.86 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|