C19H17ClO6 — CID 19618021
4-[[4-[(E)-2-carboxyethenyl]-2-chloro-6-ethoxyphenoxy]methyl]benzoic acid (PubChem CID 19618021) has the molecular formula C19H17ClO6 and a molecular weight of 376.79 g/mol. Its IUPAC name is 4-[[4-[(E)-2-carboxyethenyl]-2-chloro-6-ethoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(E)-2-carboxyethenyl]-2-chloro-6-ethoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 19618021 |
| Molecular Formula | C19H17ClO6 |
| Molecular Weight | 376.79 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 4-[[4-[(E)-2-carboxyethenyl]-2-chloro-6-ethoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=C/C(=O)O)cc(Cl)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C19H17ClO6/c1-2-25-16-10-13(5-8-17(21)22)9-15(20)18(16)26-11-12-3-6-14(7-4-12)19(23)24/h3-10H,2,11H2,1H3,(H,21,22)(H,23,24)/b8-5+ |
| InChIKey | WDJUKEJJPLXYEG-VMPITWQZSA-N |
| XLogP | 4.11 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.79 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|