C16H11Cl2FO3 — CID 4687135
3-[3,5-dichloro-4-[(4-fluorophenyl)methoxy]phenyl]prop-2-enoic acid (PubChem CID 4687135) has the molecular formula C16H11Cl2FO3 and a molecular weight of 341.17 g/mol. Its IUPAC name is 3-[3,5-dichloro-4-[(4-fluorophenyl)methoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3,5-dichloro-4-[(4-fluorophenyl)methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 4687135 |
| Molecular Formula | C16H11Cl2FO3 |
| Molecular Weight | 341.17 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 3-[3,5-dichloro-4-[(4-fluorophenyl)methoxy]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cc(Cl)c(OCc2ccc(F)cc2)c(Cl)c1 |
| InChI | InChI=1S/C16H11Cl2FO3/c17-13-7-11(3-6-15(20)21)8-14(18)16(13)22-9-10-1-4-12(19)5-2-10/h1-8H,9H2,(H,20,21) |
| InChIKey | NKBYHMYKGIUBAZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.17 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|