C18H15Cl3O4 — CID 171146613
3-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enoic acid (PubChem CID 171146613) has the molecular formula C18H15Cl3O4 and a molecular weight of 401.67 g/mol. Its IUPAC name is 3-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 171146613 |
| Molecular Formula | C18H15Cl3O4 |
| Molecular Weight | 401.67 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | 3-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]prop-2-enoic acid |
| SMILES | CCOc1cc(C=CC(=O)O)cc(Cl)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H15Cl3O4/c1-2-24-16-8-11(3-6-17(22)23)7-15(21)18(16)25-10-12-4-5-13(19)9-14(12)20/h3-9H,2,10H2,1H3,(H,22,23) |
| InChIKey | GJCNBGWABRDSOC-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.67 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|