C16H11Cl3O3 — CID 20994416
3-[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enoic acid (PubChem CID 20994416) has the molecular formula C16H11Cl3O3 and a molecular weight of 357.62 g/mol. Its IUPAC name is 3-[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 20994416 |
| Molecular Formula | C16H11Cl3O3 |
| Molecular Weight | 357.62 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 3-[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cc(Cl)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H11Cl3O3/c17-12-4-5-15(10(7-12)2-6-16(20)21)22-9-11-1-3-13(18)8-14(11)19/h1-8H,9H2,(H,20,21) |
| InChIKey | GHVYWNHNSKEQMX-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|