C16H10Cl4O3 — CID 22681382
3-[5-chloro-2-[(2,3,6-trichlorophenyl)methoxy]phenyl]prop-2-enoic acid (PubChem CID 22681382) has the molecular formula C16H10Cl4O3 and a molecular weight of 392.07 g/mol. Its IUPAC name is 3-[5-chloro-2-[(2,3,6-trichlorophenyl)methoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[5-chloro-2-[(2,3,6-trichlorophenyl)methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22681382 |
| Molecular Formula | C16H10Cl4O3 |
| Molecular Weight | 392.07 g/mol |
| Exact Mass | 389.94 |
| IUPAC Name | 3-[5-chloro-2-[(2,3,6-trichlorophenyl)methoxy]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cc(Cl)ccc1OCc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C16H10Cl4O3/c17-10-2-5-14(9(7-10)1-6-15(21)22)23-8-11-12(18)3-4-13(19)16(11)20/h1-7H,8H2,(H,21,22) |
| InChIKey | LOXPXWLBRPWULS-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.07 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|