C17H13Cl3O4 — CID 20988174
3-[3-methoxy-4-[(2,3,6-trichlorophenyl)methoxy]phenyl]prop-2-enoic acid (PubChem CID 20988174) has the molecular formula C17H13Cl3O4 and a molecular weight of 387.65 g/mol. Its IUPAC name is 3-[3-methoxy-4-[(2,3,6-trichlorophenyl)methoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-methoxy-4-[(2,3,6-trichlorophenyl)methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 20988174 |
| Molecular Formula | C17H13Cl3O4 |
| Molecular Weight | 387.65 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | 3-[3-methoxy-4-[(2,3,6-trichlorophenyl)methoxy]phenyl]prop-2-enoic acid |
| SMILES | COc1cc(C=CC(=O)O)ccc1OCc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C17H13Cl3O4/c1-23-15-8-10(3-7-16(21)22)2-6-14(15)24-9-11-12(18)4-5-13(19)17(11)20/h2-8H,9H2,1H3,(H,21,22) |
| InChIKey | IWFDOOUFERZICR-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.65 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|