C14H14ClN3O3 — CID 77098685
3-[5-chloro-2-[(2-ethyl-1,2,4-triazol-3-yl)methoxy]phenyl]prop-2-enoic acid (PubChem CID 77098685) has the molecular formula C14H14ClN3O3 and a molecular weight of 307.74 g/mol. Its IUPAC name is 3-[5-chloro-2-[(2-ethyl-1,2,4-triazol-3-yl)methoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[5-chloro-2-[(2-ethyl-1,2,4-triazol-3-yl)methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77098685 |
| Molecular Formula | C14H14ClN3O3 |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 3-[5-chloro-2-[(2-ethyl-1,2,4-triazol-3-yl)methoxy]phenyl]prop-2-enoic acid |
| SMILES | CCn1ncnc1COc1ccc(Cl)cc1C=CC(=O)O |
| InChI | InChI=1S/C14H14ClN3O3/c1-2-18-13(16-9-17-18)8-21-12-5-4-11(15)7-10(12)3-6-14(19)20/h3-7,9H,2,8H2,1H3,(H,19,20) |
| InChIKey | KBNSPMJFKGZMQU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|