C23H19ClO4 — CID 22680952
3-[5-chloro-2-[2-(4-phenylphenoxy)ethoxy]phenyl]prop-2-enoic acid (PubChem CID 22680952) has the molecular formula C23H19ClO4 and a molecular weight of 394.85 g/mol. Its IUPAC name is 3-[5-chloro-2-[2-(4-phenylphenoxy)ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[5-chloro-2-[2-(4-phenylphenoxy)ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22680952 |
| Molecular Formula | C23H19ClO4 |
| Molecular Weight | 394.85 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 3-[5-chloro-2-[2-(4-phenylphenoxy)ethoxy]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cc(Cl)ccc1OCCOc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19ClO4/c24-20-9-12-22(19(16-20)8-13-23(25)26)28-15-14-27-21-10-6-18(7-11-21)17-4-2-1-3-5-17/h1-13,16H,14-15H2,(H,25,26) |
| InChIKey | QZWJGXGZRXTGJK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.85 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|