C17H14Cl2O4 — CID 20993022
3-[4-[2-(2,4-dichlorophenoxy)ethoxy]phenyl]prop-2-enoic acid (PubChem CID 20993022) has the molecular formula C17H14Cl2O4 and a molecular weight of 353.20 g/mol. Its IUPAC name is 3-[4-[2-(2,4-dichlorophenoxy)ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[2-(2,4-dichlorophenoxy)ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 20993022 |
| Molecular Formula | C17H14Cl2O4 |
| Molecular Weight | 353.20 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 3-[4-[2-(2,4-dichlorophenoxy)ethoxy]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(OCCOc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H14Cl2O4/c18-13-4-7-16(15(19)11-13)23-10-9-22-14-5-1-12(2-6-14)3-8-17(20)21/h1-8,11H,9-10H2,(H,20,21) |
| InChIKey | JRMWZLFCDHZNND-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.20 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|