C15H10Cl2O3 — CID 22684235
3-[4-(2,5-dichlorophenoxy)phenyl]prop-2-enoic acid (PubChem CID 22684235) has the molecular formula C15H10Cl2O3 and a molecular weight of 309.15 g/mol. Its IUPAC name is 3-[4-(2,5-dichlorophenoxy)phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-(2,5-dichlorophenoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22684235 |
| Molecular Formula | C15H10Cl2O3 |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 3-[4-(2,5-dichlorophenoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(Oc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C15H10Cl2O3/c16-11-4-7-13(17)14(9-11)20-12-5-1-10(2-6-12)3-8-15(18)19/h1-9H,(H,18,19) |
| InChIKey | HDXUJJUXHHEBQD-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|