C17H15ClO3 — CID 22683399
3-[4-(4-chloro-3,5-dimethylphenoxy)phenyl]prop-2-enoic acid (PubChem CID 22683399) has the molecular formula C17H15ClO3 and a molecular weight of 302.76 g/mol. Its IUPAC name is 3-[4-(4-chloro-3,5-dimethylphenoxy)phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-(4-chloro-3,5-dimethylphenoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22683399 |
| Molecular Formula | C17H15ClO3 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 3-[4-(4-chloro-3,5-dimethylphenoxy)phenyl]prop-2-enoic acid |
| SMILES | Cc1cc(Oc2ccc(C=CC(=O)O)cc2)cc(C)c1Cl |
| InChI | InChI=1S/C17H15ClO3/c1-11-9-15(10-12(2)17(11)18)21-14-6-3-13(4-7-14)5-8-16(19)20/h3-10H,1-2H3,(H,19,20) |
| InChIKey | HILSTVHPMDVKRK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|